C8H12BrNO5 — CID 23440073
4-bromobutanoic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 23440073) has the molecular formula C8H12BrNO5 and a molecular weight of 282.09 g/mol. Its IUPAC name is 4-bromobutanoic acid;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | 4-bromobutanoic acid;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 23440073 |
| Molecular Formula | C8H12BrNO5 |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 4-bromobutanoic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C(O)CCCBr.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C4H7BrO2.C4H5NO3/c5-3-1-2-4(6)7;6-3-1-2-4(7)5(3)8/h1-3H2,(H,6,7);8H,1-2H2 |
| InChIKey | WJIDMPOAMQEHCH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|