C4H8N2O3 — CID 11073454
azane;1-hydroxypyrrolidine-2,5-dione (PubChem CID 11073454) has the molecular formula C4H8N2O3 and a molecular weight of 132.12 g/mol. Its IUPAC name is azane;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | azane;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11073454 |
| Molecular Formula | C4H8N2O3 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | azane;1-hydroxypyrrolidine-2,5-dione |
| SMILES | N.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C4H5NO3.H3N/c6-3-1-2-4(7)5(3)8;/h8H,1-2H2;1H3 |
| InChIKey | HAPXEGOGOCEQAH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|