C8H11NO9 — CID 174888237
2,3-dihydroxybutanedioic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 174888237) has the molecular formula C8H11NO9 and a molecular weight of 265.17 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | 2,3-dihydroxybutanedioic acid;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 174888237 |
| Molecular Formula | C8H11NO9 |
| Molecular Weight | 265.17 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C(O)C(O)C(O)C(=O)O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C4H5NO3.C4H6O6/c6-3-1-2-4(7)5(3)8;5-1(3(7)8)2(6)4(9)10/h8H,1-2H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | XZABBRVNIUBANI-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.17 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|