C10H12N2O6 — CID 161237221
carbonic acid;1-hydroxypyrrolidine-2,5-dione;pyridine (PubChem CID 161237221) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is carbonic acid;1-hydroxypyrrolidine-2,5-dione;pyridine.
| Compound Name | carbonic acid;1-hydroxypyrrolidine-2,5-dione;pyridine |
|---|---|
| PubChem CID | 161237221 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | carbonic acid;1-hydroxypyrrolidine-2,5-dione;pyridine |
| SMILES | O=C(O)O.O=C1CCC(=O)N1O.c1ccncc1 |
| InChI | InChI=1S/C5H5N.C4H5NO3.CH2O3/c1-2-4-6-5-3-1;6-3-1-2-4(7)5(3)8;2-1(3)4/h1-5H;8H,1-2H2;(H2,2,3,4) |
| InChIKey | UZNNQNKNPGSAHI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|