About ethene;1-hydroxypyrrolidine-2,5-dione
ethene;1-hydroxypyrrolidine-2,5-dione (PubChem CID 142301114) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is ethene;1-hydroxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | ethene;1-hydroxypyrrolidine-2,5-dione |
| PubChem CID | 142301114 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | ethene;1-hydroxypyrrolidine-2,5-dione |
| SMILES | C=C.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C4H5NO3.C2H4/c6-3-1-2-4(7)5(3)8;1-2/h8H,1-2H2;1-2H2 |
| InChIKey | LTBORMYIFWCQJZ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-hydroxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-hydroxypyrrolidine-2,5-dione?
The IUPAC name of ethene;1-hydroxypyrrolidine-2,5-dione (CID 142301114) is ethene;1-hydroxypyrrolidine-2,5-dione.
What is the SMILES notation for ethene;1-hydroxypyrrolidine-2,5-dione?
The canonical SMILES for ethene;1-hydroxypyrrolidine-2,5-dione is C=C.O=C1CCC(=O)N1O.
What is the InChIKey of ethene;1-hydroxypyrrolidine-2,5-dione?
The InChIKey is LTBORMYIFWCQJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3.C2H4/c6-3-1-2-4(7)5(3)8;1-2/h8H,1-2H2;1-2H2.
What are the key properties of ethene;1-hydroxypyrrolidine-2,5-dione?
ethene;1-hydroxypyrrolidine-2,5-dione has a molecular weight of 143.14 g/mol, XLogP of 0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-hydroxypyrrolidine-2,5-dione is sourced from PubChem (CID 142301114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).