C4H5NO3 — CID 20762892
3,3,4-trideuterio-1-hydroxypyrrolidine-2,5-dione (PubChem CID 20762892) has the molecular formula C4H5NO3 and a molecular weight of 118.11 g/mol. Its IUPAC name is 3,3,4-trideuterio-1-hydroxypyrrolidine-2,5-dione.
| Compound Name | 3,3,4-trideuterio-1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 20762892 |
| Molecular Formula | C4H5NO3 |
| Molecular Weight | 118.11 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 3,3,4-trideuterio-1-hydroxypyrrolidine-2,5-dione |
| SMILES | [2H]C1C(=O)N(O)C(=O)C1([2H])[2H] |
| InChI | InChI=1S/C4H5NO3/c6-3-1-2-4(7)5(3)8/h8H,1-2H2/i1D,2D2 |
| InChIKey | NQTADLQHYWFPDB-APAIHEESSA-N |
| XLogP | -0.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.11 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|