C7H12NO8P — CID 175009654
1-hydroxypyrrolidine-2,5-dione;3-phosphonopropanoic acid (PubChem CID 175009654) has the molecular formula C7H12NO8P and a molecular weight of 269.15 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;3-phosphonopropanoic acid.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;3-phosphonopropanoic acid |
|---|---|
| PubChem CID | 175009654 |
| Molecular Formula | C7H12NO8P |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;3-phosphonopropanoic acid |
| SMILES | O=C(O)CCP(=O)(O)O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C4H5NO3.C3H7O5P/c6-3-1-2-4(7)5(3)8;4-3(5)1-2-9(6,7)8/h8H,1-2H2;1-2H2,(H,4,5)(H2,6,7,8) |
| InChIKey | VKYKXSUJCDPIPD-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|