C13H17NO3 — CID 158046722
1-hydroxypyrrolidine-2,5-dione;1,3,5-trimethylbenzene (PubChem CID 158046722) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;1,3,5-trimethylbenzene.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 158046722 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C9H12.C4H5NO3/c1-7-4-8(2)6-9(3)5-7;6-3-1-2-4(7)5(3)8/h4-6H,1-3H3;8H,1-2H2 |
| InChIKey | FIZRXCPCVBNILR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|