C10H18N2O5 — CID 66780304
6-aminohexanoic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 66780304) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is 6-aminohexanoic acid;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | 6-aminohexanoic acid;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 66780304 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 6-aminohexanoic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | NCCCCCC(=O)O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C6H13NO2.C4H5NO3/c7-5-3-1-2-4-6(8)9;6-3-1-2-4(7)5(3)8/h1-5,7H2,(H,8,9);8H,1-2H2 |
| InChIKey | URLOWBXNQIYFHV-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|