About tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate
tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate (PubChem CID 14009399) has the molecular formula C8H11NNa4O6
and a molecular weight of 309.14 g/mol. Its IUPAC name is tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate.
Molecular Properties
| Compound Name | tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate |
| PubChem CID | 14009399 |
| Molecular Formula | C8H11NNa4O6 |
| Molecular Weight | 309.14 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate |
| SMILES | O=C([O-])CCC([O-])NC([O-])CCC(=O)[O-].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C8H13NO6.4Na/c10-5(1-3-7(12)13)9-6(11)2-4-8(14)15;;;;/h5-6,9H,1-4H2,(H,12,13)(H,14,15);;;;/q-2;4*+1/p-2 |
| InChIKey | BVXNHBNHAMEMCH-UHFFFAOYSA-L |
| XLogP | -16.98 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.14 |
| LogP ≤ 5 | -16.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate?
The IUPAC name of tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate (CID 14009399) is tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate.
What is the SMILES notation for tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate?
The canonical SMILES for tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate is O=C([O-])CCC([O-])NC([O-])CCC(=O)[O-].[Na+].[Na+].[Na+].[Na+].
What is the InChIKey of tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate?
The InChIKey is BVXNHBNHAMEMCH-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H13NO6.4Na/c10-5(1-3-7(12)13)9-6(11)2-4-8(14)15;;;;/h5-6,9H,1-4H2,(H,12,13)(H,14,15);;;;/q-2;4*+1/p-2.
What are the key properties of tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate?
tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate has a molecular weight of 309.14 g/mol, XLogP of -16.98, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tetrasodium;4-[(3-carboxylato-1-oxidopropyl)amino]-4-oxidobutanoate is sourced from PubChem (CID 14009399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).