C7H7O6-3 — CID 7000096
(2S)-butane-1,2,4-tricarboxylate (PubChem CID 7000096) has the molecular formula C7H7O6-3 and a molecular weight of 187.13 g/mol. Its IUPAC name is (2S)-butane-1,2,4-tricarboxylate.
| Compound Name | (2S)-butane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 7000096 |
| Molecular Formula | C7H7O6-3 |
| Molecular Weight | 187.13 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | (2S)-butane-1,2,4-tricarboxylate |
| SMILES | O=C([O-])CC[C@@H](CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H10O6/c8-5(9)2-1-4(7(12)13)3-6(10)11/h4H,1-3H2,(H,8,9)(H,10,11)(H,12,13)/p-3/t4-/m0/s1 |
| InChIKey | LOGBRYZYTBQBTB-BYPYZUCNSA-K |
| XLogP | -3.98 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.13 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |