C6H5GaO6 — CID 175397549
gallium propane-1,2,3-tricarboxylate (PubChem CID 175397549) has the molecular formula C6H5GaO6 and a molecular weight of 242.82 g/mol. Its IUPAC name is gallium propane-1,2,3-tricarboxylate.
| Compound Name | gallium propane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 175397549 |
| Molecular Formula | C6H5GaO6 |
| Molecular Weight | 242.82 g/mol |
| Exact Mass | 241.93 |
| IUPAC Name | gallium propane-1,2,3-tricarboxylate |
| SMILES | O=C([O-])CC(CC(=O)[O-])C(=O)[O-].[Ga+3] |
| InChI | InChI=1S/C6H8O6.Ga/c7-4(8)1-3(6(11)12)2-5(9)10;/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+3/p-3 |
| InChIKey | QHMZQTJDJGAHJH-UHFFFAOYSA-K |
| XLogP | -4.75 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.82 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |