About 2-aminobutanedioate
2-aminobutanedioate (PubChem CID 4519554) has the molecular formula C4H5NO4-2
and a molecular weight of 131.09 g/mol. Its IUPAC name is 2-aminobutanedioate.
Molecular Properties
| Compound Name | 2-aminobutanedioate |
| PubChem CID | 4519554 |
| Molecular Formula | C4H5NO4-2 |
| Molecular Weight | 131.09 g/mol |
| Exact Mass | 131.02 |
| IUPAC Name | 2-aminobutanedioate |
| SMILES | NC(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/p-2 |
| InChIKey | CKLJMWTZIZZHCS-UHFFFAOYSA-L |
| XLogP | -3.80 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.09 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanedioate?
The IUPAC name of 2-aminobutanedioate (CID 4519554) is 2-aminobutanedioate.
What is the SMILES notation for 2-aminobutanedioate?
The canonical SMILES for 2-aminobutanedioate is NC(CC(=O)[O-])C(=O)[O-].
What is the InChIKey of 2-aminobutanedioate?
The InChIKey is CKLJMWTZIZZHCS-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/p-2.
What are the key properties of 2-aminobutanedioate?
2-aminobutanedioate has a molecular weight of 131.09 g/mol, XLogP of -3.80, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanedioate is sourced from PubChem (CID 4519554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).