About calcium;(2S)-2-aminobutanedioate;trihydrate
calcium;(2S)-2-aminobutanedioate;trihydrate (PubChem CID 139890017) has the molecular formula C4H11CaNO7
and a molecular weight of 225.21 g/mol. Its IUPAC name is calcium;(2S)-2-aminobutanedioate;trihydrate.
Molecular Properties
| Compound Name | calcium;(2S)-2-aminobutanedioate;trihydrate |
| PubChem CID | 139890017 |
| Molecular Formula | C4H11CaNO7 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | calcium;(2S)-2-aminobutanedioate;trihydrate |
| SMILES | N[C@@H](CC(=O)[O-])C(=O)[O-].O.O.O.[Ca+2] |
| InChI | InChI=1S/C4H7NO4.Ca.3H2O/c5-2(4(8)9)1-3(6)7;;;;/h2H,1,5H2,(H,6,7)(H,8,9);;3*1H2/q;+2;;;/p-2/t2-;;;;/m0..../s1 |
| InChIKey | DQPCESFUQXWBMX-AIDJSRAFSA-L |
| XLogP | -6.65 |
| TPSA | 200.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze calcium;(2S)-2-aminobutanedioate;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;(2S)-2-aminobutanedioate;trihydrate?
The IUPAC name of calcium;(2S)-2-aminobutanedioate;trihydrate (CID 139890017) is calcium;(2S)-2-aminobutanedioate;trihydrate.
What is the SMILES notation for calcium;(2S)-2-aminobutanedioate;trihydrate?
The canonical SMILES for calcium;(2S)-2-aminobutanedioate;trihydrate is N[C@@H](CC(=O)[O-])C(=O)[O-].O.O.O.[Ca+2].
What is the InChIKey of calcium;(2S)-2-aminobutanedioate;trihydrate?
The InChIKey is DQPCESFUQXWBMX-AIDJSRAFSA-L. The full InChI is InChI=1S/C4H7NO4.Ca.3H2O/c5-2(4(8)9)1-3(6)7;;;;/h2H,1,5H2,(H,6,7)(H,8,9);;3*1H2/q;+2;;;/p-2/t2-;;;;/m0..../s1.
What are the key properties of calcium;(2S)-2-aminobutanedioate;trihydrate?
calcium;(2S)-2-aminobutanedioate;trihydrate has a molecular weight of 225.21 g/mol, XLogP of -6.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;(2S)-2-aminobutanedioate;trihydrate is sourced from PubChem (CID 139890017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).