About calcium;2-aminobutanedioate;hydrochloride
calcium;2-aminobutanedioate;hydrochloride (PubChem CID 19880069) has the molecular formula C4H6CaClNO4
and a molecular weight of 207.63 g/mol. Its IUPAC name is calcium;2-aminobutanedioate;hydrochloride.
Molecular Properties
| Compound Name | calcium;2-aminobutanedioate;hydrochloride |
| PubChem CID | 19880069 |
| Molecular Formula | C4H6CaClNO4 |
| Molecular Weight | 207.63 g/mol |
| Exact Mass | 206.96 |
| IUPAC Name | calcium;2-aminobutanedioate;hydrochloride |
| SMILES | Cl.NC(CC(=O)[O-])C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C4H7NO4.Ca.ClH/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;1H/q;+2;/p-2 |
| InChIKey | LUUAAIHWKUJNKC-UHFFFAOYSA-L |
| XLogP | -3.76 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.63 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze calcium;2-aminobutanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;2-aminobutanedioate;hydrochloride?
The IUPAC name of calcium;2-aminobutanedioate;hydrochloride (CID 19880069) is calcium;2-aminobutanedioate;hydrochloride.
What is the SMILES notation for calcium;2-aminobutanedioate;hydrochloride?
The canonical SMILES for calcium;2-aminobutanedioate;hydrochloride is Cl.NC(CC(=O)[O-])C(=O)[O-].[Ca+2].
What is the InChIKey of calcium;2-aminobutanedioate;hydrochloride?
The InChIKey is LUUAAIHWKUJNKC-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H7NO4.Ca.ClH/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;1H/q;+2;/p-2.
What are the key properties of calcium;2-aminobutanedioate;hydrochloride?
calcium;2-aminobutanedioate;hydrochloride has a molecular weight of 207.63 g/mol, XLogP of -3.76, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;2-aminobutanedioate;hydrochloride is sourced from PubChem (CID 19880069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).