About (2S)-2-aminobutanedioate;silver
(2S)-2-aminobutanedioate;silver (PubChem CID 87272123) has the molecular formula C4H5AgNO4-2
and a molecular weight of 238.95 g/mol. Its IUPAC name is (2S)-2-aminobutanedioate;silver.
Molecular Properties
| Compound Name | (2S)-2-aminobutanedioate;silver |
| PubChem CID | 87272123 |
| Molecular Formula | C4H5AgNO4-2 |
| Molecular Weight | 238.95 g/mol |
| Exact Mass | 237.93 |
| IUPAC Name | (2S)-2-aminobutanedioate;silver |
| SMILES | N[C@@H](CC(=O)[O-])C(=O)[O-].[Ag] |
| InChI | InChI=1S/C4H7NO4.Ag/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/p-2/t2-;/m0./s1 |
| InChIKey | QXXSGHILLPMQKK-DKWTVANSSA-L |
| XLogP | -3.80 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.95 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-aminobutanedioate;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminobutanedioate;silver?
The IUPAC name of (2S)-2-aminobutanedioate;silver (CID 87272123) is (2S)-2-aminobutanedioate;silver.
What is the SMILES notation for (2S)-2-aminobutanedioate;silver?
The canonical SMILES for (2S)-2-aminobutanedioate;silver is N[C@@H](CC(=O)[O-])C(=O)[O-].[Ag].
What is the InChIKey of (2S)-2-aminobutanedioate;silver?
The InChIKey is QXXSGHILLPMQKK-DKWTVANSSA-L. The full InChI is InChI=1S/C4H7NO4.Ag/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/p-2/t2-;/m0./s1.
What are the key properties of (2S)-2-aminobutanedioate;silver?
(2S)-2-aminobutanedioate;silver has a molecular weight of 238.95 g/mol, XLogP of -3.80, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminobutanedioate;silver is sourced from PubChem (CID 87272123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).