About dicesium;(2S)-2-aminobutanedioate
dicesium;(2S)-2-aminobutanedioate (PubChem CID 11639845) has the molecular formula C4H5Cs2NO4
and a molecular weight of 396.90 g/mol. Its IUPAC name is dicesium;(2S)-2-aminobutanedioate.
Molecular Properties
| Compound Name | dicesium;(2S)-2-aminobutanedioate |
| PubChem CID | 11639845 |
| Molecular Formula | C4H5Cs2NO4 |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.83 |
| IUPAC Name | dicesium;(2S)-2-aminobutanedioate |
| SMILES | N[C@@H](CC(=O)[O-])C(=O)[O-].[Cs+].[Cs+] |
| InChI | InChI=1S/C4H7NO4.2Cs/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;/q;2*+1/p-2/t2-;;/m0../s1 |
| InChIKey | VRRJYERADSBBPI-JIZZDEOASA-L |
| XLogP | -9.79 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | -9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dicesium;(2S)-2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicesium;(2S)-2-aminobutanedioate?
The IUPAC name of dicesium;(2S)-2-aminobutanedioate (CID 11639845) is dicesium;(2S)-2-aminobutanedioate.
What is the SMILES notation for dicesium;(2S)-2-aminobutanedioate?
The canonical SMILES for dicesium;(2S)-2-aminobutanedioate is N[C@@H](CC(=O)[O-])C(=O)[O-].[Cs+].[Cs+].
What is the InChIKey of dicesium;(2S)-2-aminobutanedioate?
The InChIKey is VRRJYERADSBBPI-JIZZDEOASA-L. The full InChI is InChI=1S/C4H7NO4.2Cs/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;/q;2*+1/p-2/t2-;;/m0../s1.
What are the key properties of dicesium;(2S)-2-aminobutanedioate?
dicesium;(2S)-2-aminobutanedioate has a molecular weight of 396.90 g/mol, XLogP of -9.79, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dicesium;(2S)-2-aminobutanedioate is sourced from PubChem (CID 11639845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).