C8H10N2O8Pb-4 — CID 21127296
CID 21127296 (PubChem CID 21127296) has the molecular formula C8H10N2O8Pb-4 and a molecular weight of 469.37 g/mol.
| Compound Name | CID 21127296 |
|---|---|
| PubChem CID | 21127296 |
| Molecular Formula | C8H10N2O8Pb-4 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | — |
| SMILES | NC(CC(=O)[O-])C(=O)[O-].NC(CC(=O)[O-])C(=O)[O-].[Pb] |
| InChI | InChI=1S/2C4H7NO4.Pb/c2*5-2(4(8)9)1-3(6)7;/h2*2H,1,5H2,(H,6,7)(H,8,9);/p-4 |
| InChIKey | VTBXFGQEBJUHNB-UHFFFAOYSA-J |
| XLogP | -7.97 |
| TPSA | 212.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | -7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |