About (2S)-2-aminobutanedioate;manganese(2+);hydrochloride
(2S)-2-aminobutanedioate;manganese(2+);hydrochloride (PubChem CID 88636151) has the molecular formula C4H6ClMnNO4
and a molecular weight of 222.49 g/mol. Its IUPAC name is (2S)-2-aminobutanedioate;manganese(2+);hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-aminobutanedioate;manganese(2+);hydrochloride |
| PubChem CID | 88636151 |
| Molecular Formula | C4H6ClMnNO4 |
| Molecular Weight | 222.49 g/mol |
| Exact Mass | 221.94 |
| IUPAC Name | (2S)-2-aminobutanedioate;manganese(2+);hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)[O-])C(=O)[O-].[Mn+2] |
| InChI | InChI=1S/C4H7NO4.ClH.Mn/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);1H;/q;;+2/p-2/t2-;;/m0../s1 |
| InChIKey | BYYLKXQFVZKTFT-JIZZDEOASA-L |
| XLogP | -3.38 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.49 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-aminobutanedioate;manganese(2+);hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminobutanedioate;manganese(2+);hydrochloride?
The IUPAC name of (2S)-2-aminobutanedioate;manganese(2+);hydrochloride (CID 88636151) is (2S)-2-aminobutanedioate;manganese(2+);hydrochloride.
What is the SMILES notation for (2S)-2-aminobutanedioate;manganese(2+);hydrochloride?
The canonical SMILES for (2S)-2-aminobutanedioate;manganese(2+);hydrochloride is Cl.N[C@@H](CC(=O)[O-])C(=O)[O-].[Mn+2].
What is the InChIKey of (2S)-2-aminobutanedioate;manganese(2+);hydrochloride?
The InChIKey is BYYLKXQFVZKTFT-JIZZDEOASA-L. The full InChI is InChI=1S/C4H7NO4.ClH.Mn/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);1H;/q;;+2/p-2/t2-;;/m0../s1.
What are the key properties of (2S)-2-aminobutanedioate;manganese(2+);hydrochloride?
(2S)-2-aminobutanedioate;manganese(2+);hydrochloride has a molecular weight of 222.49 g/mol, XLogP of -3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminobutanedioate;manganese(2+);hydrochloride is sourced from PubChem (CID 88636151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).