About disodium;2-aminobutanedioate
disodium;2-aminobutanedioate (PubChem CID 172873588) has the molecular formula C4H5NNa2O4
and a molecular weight of 177.07 g/mol. Its IUPAC name is disodium;2-aminobutanedioate.
Molecular Properties
| Compound Name | disodium;2-aminobutanedioate |
| PubChem CID | 172873588 |
| Molecular Formula | C4H5NNa2O4 |
| Molecular Weight | 177.07 g/mol |
| Exact Mass | 177.00 |
| IUPAC Name | disodium;2-aminobutanedioate |
| SMILES | NC(CC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H7NO4.2Na/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;/q;2*+1/p-2 |
| InChIKey | XMXOIHIZTOVVFB-UHFFFAOYSA-L |
| XLogP | -9.79 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.07 |
| LogP ≤ 5 | -9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze disodium;2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-aminobutanedioate?
The IUPAC name of disodium;2-aminobutanedioate (CID 172873588) is disodium;2-aminobutanedioate.
What is the SMILES notation for disodium;2-aminobutanedioate?
The canonical SMILES for disodium;2-aminobutanedioate is NC(CC(=O)[O-])C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-aminobutanedioate?
The InChIKey is XMXOIHIZTOVVFB-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H7NO4.2Na/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;/q;2*+1/p-2.
What are the key properties of disodium;2-aminobutanedioate?
disodium;2-aminobutanedioate has a molecular weight of 177.07 g/mol, XLogP of -9.79, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-aminobutanedioate is sourced from PubChem (CID 172873588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).