About 2-bromopentanedioate
2-bromopentanedioate (PubChem CID 18539512) has the molecular formula C5H5BrO4-2
and a molecular weight of 208.99 g/mol. Its IUPAC name is 2-bromopentanedioate.
Molecular Properties
| Compound Name | 2-bromopentanedioate |
| PubChem CID | 18539512 |
| Molecular Formula | C5H5BrO4-2 |
| Molecular Weight | 208.99 g/mol |
| Exact Mass | 207.94 |
| IUPAC Name | 2-bromopentanedioate |
| SMILES | O=C([O-])CCC(Br)C(=O)[O-] |
| InChI | InChI=1S/C5H7BrO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2H2,(H,7,8)(H,9,10)/p-2 |
| InChIKey | UKUBAEDKWAHORT-UHFFFAOYSA-L |
| XLogP | -1.97 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.99 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopentanedioate?
The IUPAC name of 2-bromopentanedioate (CID 18539512) is 2-bromopentanedioate.
What is the SMILES notation for 2-bromopentanedioate?
The canonical SMILES for 2-bromopentanedioate is O=C([O-])CCC(Br)C(=O)[O-].
What is the InChIKey of 2-bromopentanedioate?
The InChIKey is UKUBAEDKWAHORT-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H7BrO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2H2,(H,7,8)(H,9,10)/p-2.
What are the key properties of 2-bromopentanedioate?
2-bromopentanedioate has a molecular weight of 208.99 g/mol, XLogP of -1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopentanedioate is sourced from PubChem (CID 18539512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).