C6H8O6-2 — CID 20505803
2,3-dihydroxyhexanedioate (PubChem CID 20505803) has the molecular formula C6H8O6-2 and a molecular weight of 176.12 g/mol. Its IUPAC name is 2,3-dihydroxyhexanedioate.
| Compound Name | 2,3-dihydroxyhexanedioate |
|---|---|
| PubChem CID | 20505803 |
| Molecular Formula | C6H8O6-2 |
| Molecular Weight | 176.12 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 2,3-dihydroxyhexanedioate |
| SMILES | O=C([O-])CCC(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O6/c7-3(1-2-4(8)9)5(10)6(11)12/h3,5,7,10H,1-2H2,(H,8,9)(H,11,12)/p-2 |
| InChIKey | ZTXIVKBKOYCSAF-UHFFFAOYSA-L |
| XLogP | -4.01 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.12 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |