C7H8O6-2 — CID 54675862
(E)-4,7-dihydroxy-6-oxido-7-oxohept-5-enoate (PubChem CID 54675862) has the molecular formula C7H8O6-2 and a molecular weight of 188.13 g/mol. Its IUPAC name is (E)-4,7-dihydroxy-6-oxido-7-oxohept-5-enoate.
| Compound Name | (E)-4,7-dihydroxy-6-oxido-7-oxohept-5-enoate |
|---|---|
| PubChem CID | 54675862 |
| Molecular Formula | C7H8O6-2 |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | (E)-4,7-dihydroxy-6-oxido-7-oxohept-5-enoate |
| SMILES | O=C([O-])CCC(O)/C=C(/[O-])C(=O)O |
| InChI | InChI=1S/C7H10O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h3-4,8-9H,1-2H2,(H,10,11)(H,12,13)/p-2/b5-3+ |
| InChIKey | APNIDHDQYISZAE-HWKANZROSA-L |
| XLogP | -2.79 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|