About disodium;(2S)-2-hydroxypentanedioate
disodium;(2S)-2-hydroxypentanedioate (PubChem CID 56845267) has the molecular formula C5H6Na2O5
and a molecular weight of 192.08 g/mol. Its IUPAC name is disodium;(2S)-2-hydroxypentanedioate.
Molecular Properties
| Compound Name | disodium;(2S)-2-hydroxypentanedioate |
| PubChem CID | 56845267 |
| Molecular Formula | C5H6Na2O5 |
| Molecular Weight | 192.08 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | disodium;(2S)-2-hydroxypentanedioate |
| SMILES | O=C([O-])CC[C@H](O)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H8O5.2Na/c6-3(5(9)10)1-2-4(7)8;;/h3,6H,1-2H2,(H,7,8)(H,9,10);;/q;2*+1/p-2/t3-;;/m0../s1 |
| InChIKey | DZHFTEDSQFPDPP-QTNFYWBSSA-L |
| XLogP | -9.36 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.08 |
| LogP ≤ 5 | -9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze disodium;(2S)-2-hydroxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(2S)-2-hydroxypentanedioate?
The IUPAC name of disodium;(2S)-2-hydroxypentanedioate (CID 56845267) is disodium;(2S)-2-hydroxypentanedioate.
What is the SMILES notation for disodium;(2S)-2-hydroxypentanedioate?
The canonical SMILES for disodium;(2S)-2-hydroxypentanedioate is O=C([O-])CC[C@H](O)C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;(2S)-2-hydroxypentanedioate?
The InChIKey is DZHFTEDSQFPDPP-QTNFYWBSSA-L. The full InChI is InChI=1S/C5H8O5.2Na/c6-3(5(9)10)1-2-4(7)8;;/h3,6H,1-2H2,(H,7,8)(H,9,10);;/q;2*+1/p-2/t3-;;/m0../s1.
What are the key properties of disodium;(2S)-2-hydroxypentanedioate?
disodium;(2S)-2-hydroxypentanedioate has a molecular weight of 192.08 g/mol, XLogP of -9.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(2S)-2-hydroxypentanedioate is sourced from PubChem (CID 56845267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).