C5H7NNa2O5 — CID 87933106
disodium;(2S)-2-(hydroxyamino)pentanedioate (PubChem CID 87933106) has the molecular formula C5H7NNa2O5 and a molecular weight of 207.09 g/mol. Its IUPAC name is disodium;(2S)-2-(hydroxyamino)pentanedioate.
| Compound Name | disodium;(2S)-2-(hydroxyamino)pentanedioate |
|---|---|
| PubChem CID | 87933106 |
| Molecular Formula | C5H7NNa2O5 |
| Molecular Weight | 207.09 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | disodium;(2S)-2-(hydroxyamino)pentanedioate |
| SMILES | O=C([O-])CC[C@H](NO)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C5H9NO5.2Na/c7-4(8)2-1-3(6-11)5(9)10;;/h3,6,11H,1-2H2,(H,7,8)(H,9,10);;/q;2*+1/p-2/t3-;;/m0../s1 |
| InChIKey | MHQHYBOQYRWZGA-QTNFYWBSSA-L |
| XLogP | -9.38 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.09 |
| LogP ≤ 5 | -9.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|