About disodium;(2S)-2-(decylamino)pentanedioate
disodium;(2S)-2-(decylamino)pentanedioate (PubChem CID 141406009) has the molecular formula C15H27NNa2O4
and a molecular weight of 331.36 g/mol. Its IUPAC name is disodium;(2S)-2-(decylamino)pentanedioate.
Molecular Properties
| Compound Name | disodium;(2S)-2-(decylamino)pentanedioate |
| PubChem CID | 141406009 |
| Molecular Formula | C15H27NNa2O4 |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | disodium;(2S)-2-(decylamino)pentanedioate |
| SMILES | CCCCCCCCCCN[C@@H](CCC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C15H29NO4.2Na/c1-2-3-4-5-6-7-8-9-12-16-13(15(19)20)10-11-14(17)18;;/h13,16H,2-12H2,1H3,(H,17,18)(H,19,20);;/q;2*+1/p-2/t13-;;/m0../s1 |
| InChIKey | KEJLKVUQGONUBW-GXKRWWSZSA-L |
| XLogP | -5.63 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | -5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze disodium;(2S)-2-(decylamino)pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(2S)-2-(decylamino)pentanedioate?
The IUPAC name of disodium;(2S)-2-(decylamino)pentanedioate (CID 141406009) is disodium;(2S)-2-(decylamino)pentanedioate.
What is the SMILES notation for disodium;(2S)-2-(decylamino)pentanedioate?
The canonical SMILES for disodium;(2S)-2-(decylamino)pentanedioate is CCCCCCCCCCN[C@@H](CCC(=O)[O-])C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;(2S)-2-(decylamino)pentanedioate?
The InChIKey is KEJLKVUQGONUBW-GXKRWWSZSA-L. The full InChI is InChI=1S/C15H29NO4.2Na/c1-2-3-4-5-6-7-8-9-12-16-13(15(19)20)10-11-14(17)18;;/h13,16H,2-12H2,1H3,(H,17,18)(H,19,20);;/q;2*+1/p-2/t13-;;/m0../s1.
What are the key properties of disodium;(2S)-2-(decylamino)pentanedioate?
disodium;(2S)-2-(decylamino)pentanedioate has a molecular weight of 331.36 g/mol, XLogP of -5.63, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(2S)-2-(decylamino)pentanedioate is sourced from PubChem (CID 141406009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).