C7H14NNaO2SSi — CID 172894479
CID 172894479 (PubChem CID 172894479) has the molecular formula C7H14NNaO2SSi and a molecular weight of 227.34 g/mol.
| Compound Name | CID 172894479 |
|---|---|
| PubChem CID | 172894479 |
| Molecular Formula | C7H14NNaO2SSi |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | — |
| SMILES | CCCCNC(CS)C(=O)[O-].[Na+].[Si] |
| InChI | InChI=1S/C7H15NO2S.Na.Si/c1-2-3-4-8-6(5-11)7(9)10;;/h6,8,11H,2-5H2,1H3,(H,9,10);;/q;+1;/p-1 |
| InChIKey | SQIHHHUJQSVODY-UHFFFAOYSA-M |
| XLogP | -3.95 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|