C8H17N3O8 — CID 87560114
diazanium;(2S)-2-(dicarboxymethylamino)pentanedioate (PubChem CID 87560114) has the molecular formula C8H17N3O8 and a molecular weight of 283.24 g/mol. Its IUPAC name is diazanium;(2S)-2-(dicarboxymethylamino)pentanedioate.
| Compound Name | diazanium;(2S)-2-(dicarboxymethylamino)pentanedioate |
|---|---|
| PubChem CID | 87560114 |
| Molecular Formula | C8H17N3O8 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | diazanium;(2S)-2-(dicarboxymethylamino)pentanedioate |
| SMILES | O=C([O-])CC[C@H](NC(C(=O)O)C(=O)O)C(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C8H11NO8.2H3N/c10-4(11)2-1-3(6(12)13)9-5(7(14)15)8(16)17;;/h3,5,9H,1-2H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17);2*1H3/t3-;;/m0../s1 |
| InChIKey | FJZZHNSAKKNYJJ-QTNFYWBSSA-N |
| XLogP | -3.49 |
| TPSA | 239.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|