C9H8O6-2 — CID 54689772
(5E,7Z)-9-hydroxy-8-oxido-4,9-dioxonona-5,7-dienoate (PubChem CID 54689772) has the molecular formula C9H8O6-2 and a molecular weight of 212.16 g/mol. Its IUPAC name is (5E,7Z)-9-hydroxy-8-oxido-4,9-dioxonona-5,7-dienoate.
| Compound Name | (5E,7Z)-9-hydroxy-8-oxido-4,9-dioxonona-5,7-dienoate |
|---|---|
| PubChem CID | 54689772 |
| Molecular Formula | C9H8O6-2 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | (5E,7Z)-9-hydroxy-8-oxido-4,9-dioxonona-5,7-dienoate |
| SMILES | O=C([O-])CCC(=O)/C=C/C=C(\[O-])C(=O)O |
| InChI | InChI=1S/C9H10O6/c10-6(4-5-8(12)13)2-1-3-7(11)9(14)15/h1-3,11H,4-5H2,(H,12,13)(H,14,15)/p-2/b2-1+,7-3- |
| InChIKey | RFENOVFRMPRRJI-YDCWOTKKSA-L |
| XLogP | -2.03 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|