C7H7O5- — CID 122706191
(2Z,4E)-1-hydroxy-6-methoxy-1,6-dioxohexa-2,4-dien-2-olate (PubChem CID 122706191) has the molecular formula C7H7O5- and a molecular weight of 171.13 g/mol. Its IUPAC name is (2Z,4E)-1-hydroxy-6-methoxy-1,6-dioxohexa-2,4-dien-2-olate.
| Compound Name | (2Z,4E)-1-hydroxy-6-methoxy-1,6-dioxohexa-2,4-dien-2-olate |
|---|---|
| PubChem CID | 122706191 |
| Molecular Formula | C7H7O5- |
| Molecular Weight | 171.13 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | (2Z,4E)-1-hydroxy-6-methoxy-1,6-dioxohexa-2,4-dien-2-olate |
| SMILES | COC(=O)/C=C/C=C(\[O-])C(=O)O |
| InChI | InChI=1S/C7H8O5/c1-12-6(9)4-2-3-5(8)7(10)11/h2-4,8H,1H3,(H,10,11)/p-1/b4-2+,5-3- |
| InChIKey | OIBKZDZZNMNCAY-HZDAAVBUSA-M |
| XLogP | -0.96 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.13 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|