C5H5O3- — CID 54675827
(2E)-1-hydroxy-1-oxopenta-2,4-dien-2-olate (PubChem CID 54675827) has the molecular formula C5H5O3- and a molecular weight of 113.09 g/mol. Its IUPAC name is (2E)-1-hydroxy-1-oxopenta-2,4-dien-2-olate.
| Compound Name | (2E)-1-hydroxy-1-oxopenta-2,4-dien-2-olate |
|---|---|
| PubChem CID | 54675827 |
| Molecular Formula | C5H5O3- |
| Molecular Weight | 113.09 g/mol |
| Exact Mass | 113.02 |
| IUPAC Name | (2E)-1-hydroxy-1-oxopenta-2,4-dien-2-olate |
| SMILES | C=C/C=C(/[O-])C(=O)O |
| InChI | InChI=1S/C5H6O3/c1-2-3-4(6)5(7)8/h2-3,6H,1H2,(H,7,8)/p-1/b4-3+ |
| InChIKey | VHTQQDXPNUTMNB-ONEGZZNKSA-M |
| XLogP | -0.50 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.09 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|