C6H4ClO4- — CID 135398053
(2Z,4E)-6-chloro-1-hydroxy-1,6-dioxohexa-2,4-dien-2-olate (PubChem CID 135398053) has the molecular formula C6H4ClO4- and a molecular weight of 175.55 g/mol. Its IUPAC name is (2Z,4E)-6-chloro-1-hydroxy-1,6-dioxohexa-2,4-dien-2-olate.
| Compound Name | (2Z,4E)-6-chloro-1-hydroxy-1,6-dioxohexa-2,4-dien-2-olate |
|---|---|
| PubChem CID | 135398053 |
| Molecular Formula | C6H4ClO4- |
| Molecular Weight | 175.55 g/mol |
| Exact Mass | 174.98 |
| IUPAC Name | (2Z,4E)-6-chloro-1-hydroxy-1,6-dioxohexa-2,4-dien-2-olate |
| SMILES | O=C(Cl)/C=C/C=C(\[O-])C(=O)O |
| InChI | InChI=1S/C6H5ClO4/c7-5(9)3-1-2-4(8)6(10)11/h1-3,8H,(H,10,11)/p-1/b3-1+,4-2- |
| InChIKey | CYWRXIILQMXSGY-TZFCGSKZSA-M |
| XLogP | -0.36 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.55 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|