About azane;hydron;2-hydroxy-2-oxoacetate
azane;hydron;2-hydroxy-2-oxoacetate (PubChem CID 173005395) has the molecular formula C2H5NO4
and a molecular weight of 107.06 g/mol. Its IUPAC name is azane;hydron;2-hydroxy-2-oxoacetate.
Molecular Properties
| Compound Name | azane;hydron;2-hydroxy-2-oxoacetate |
| PubChem CID | 173005395 |
| Molecular Formula | C2H5NO4 |
| Molecular Weight | 107.06 g/mol |
| Exact Mass | 107.02 |
| IUPAC Name | azane;hydron;2-hydroxy-2-oxoacetate |
| SMILES | N.O=C([O-])C(=O)O.[H+] |
| InChI | InChI=1S/C2H2O4.H3N/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);1H3 |
| InChIKey | AJGPQPPJQDDCDA-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.06 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze azane;hydron;2-hydroxy-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;hydron;2-hydroxy-2-oxoacetate?
The IUPAC name of azane;hydron;2-hydroxy-2-oxoacetate (CID 173005395) is azane;hydron;2-hydroxy-2-oxoacetate.
What is the SMILES notation for azane;hydron;2-hydroxy-2-oxoacetate?
The canonical SMILES for azane;hydron;2-hydroxy-2-oxoacetate is N.O=C([O-])C(=O)O.[H+].
What is the InChIKey of azane;hydron;2-hydroxy-2-oxoacetate?
The InChIKey is AJGPQPPJQDDCDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.H3N/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);1H3.
What are the key properties of azane;hydron;2-hydroxy-2-oxoacetate?
azane;hydron;2-hydroxy-2-oxoacetate has a molecular weight of 107.06 g/mol, XLogP of -1.90, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hydron;2-hydroxy-2-oxoacetate is sourced from PubChem (CID 173005395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).