About dipotassium;2-hydroxy-2-oxoacetate;nitrite
dipotassium;2-hydroxy-2-oxoacetate;nitrite (PubChem CID 176892574) has the molecular formula C2HK2NO6
and a molecular weight of 213.23 g/mol. Its IUPAC name is dipotassium;2-hydroxy-2-oxoacetate;nitrite.
Molecular Properties
| Compound Name | dipotassium;2-hydroxy-2-oxoacetate;nitrite |
| PubChem CID | 176892574 |
| Molecular Formula | C2HK2NO6 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 212.91 |
| IUPAC Name | dipotassium;2-hydroxy-2-oxoacetate;nitrite |
| SMILES | O=C([O-])C(=O)O.O=N[O-].[K+].[K+] |
| InChI | InChI=1S/C2H2O4.2K.HNO2/c3-1(4)2(5)6;;;2-1-3/h(H,3,4)(H,5,6);;;(H,2,3)/q;2*+1;/p-2 |
| InChIKey | GAHPICDGSHVOGS-UHFFFAOYSA-L |
| XLogP | -7.92 |
| TPSA | 129.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-hydroxy-2-oxoacetate;nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-hydroxy-2-oxoacetate;nitrite?
The IUPAC name of dipotassium;2-hydroxy-2-oxoacetate;nitrite (CID 176892574) is dipotassium;2-hydroxy-2-oxoacetate;nitrite.
What is the SMILES notation for dipotassium;2-hydroxy-2-oxoacetate;nitrite?
The canonical SMILES for dipotassium;2-hydroxy-2-oxoacetate;nitrite is O=C([O-])C(=O)O.O=N[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-hydroxy-2-oxoacetate;nitrite?
The InChIKey is GAHPICDGSHVOGS-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.2K.HNO2/c3-1(4)2(5)6;;;2-1-3/h(H,3,4)(H,5,6);;;(H,2,3)/q;2*+1;/p-2.
What are the key properties of dipotassium;2-hydroxy-2-oxoacetate;nitrite?
dipotassium;2-hydroxy-2-oxoacetate;nitrite has a molecular weight of 213.23 g/mol, XLogP of -7.92, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-hydroxy-2-oxoacetate;nitrite is sourced from PubChem (CID 176892574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).