About sodium;2-hydroxy-2-oxoacetate;hydrochloride
sodium;2-hydroxy-2-oxoacetate;hydrochloride (PubChem CID 141113765) has the molecular formula C2H2ClNaO4
and a molecular weight of 148.48 g/mol. Its IUPAC name is sodium;2-hydroxy-2-oxoacetate;hydrochloride.
Molecular Properties
| Compound Name | sodium;2-hydroxy-2-oxoacetate;hydrochloride |
| PubChem CID | 141113765 |
| Molecular Formula | C2H2ClNaO4 |
| Molecular Weight | 148.48 g/mol |
| Exact Mass | 147.95 |
| IUPAC Name | sodium;2-hydroxy-2-oxoacetate;hydrochloride |
| SMILES | Cl.O=C([O-])C(=O)O.[Na+] |
| InChI | InChI=1S/C2H2O4.ClH.Na/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);1H;/q;;+1/p-1 |
| InChIKey | MVTYCFQIEQHIGB-UHFFFAOYSA-M |
| XLogP | -4.75 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.48 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-hydroxy-2-oxoacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-hydroxy-2-oxoacetate;hydrochloride?
The IUPAC name of sodium;2-hydroxy-2-oxoacetate;hydrochloride (CID 141113765) is sodium;2-hydroxy-2-oxoacetate;hydrochloride.
What is the SMILES notation for sodium;2-hydroxy-2-oxoacetate;hydrochloride?
The canonical SMILES for sodium;2-hydroxy-2-oxoacetate;hydrochloride is Cl.O=C([O-])C(=O)O.[Na+].
What is the InChIKey of sodium;2-hydroxy-2-oxoacetate;hydrochloride?
The InChIKey is MVTYCFQIEQHIGB-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H2O4.ClH.Na/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);1H;/q;;+1/p-1.
What are the key properties of sodium;2-hydroxy-2-oxoacetate;hydrochloride?
sodium;2-hydroxy-2-oxoacetate;hydrochloride has a molecular weight of 148.48 g/mol, XLogP of -4.75, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-hydroxy-2-oxoacetate;hydrochloride is sourced from PubChem (CID 141113765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).