About bis(2-hydroxy-2-oxoacetate);oxotitanium
bis(2-hydroxy-2-oxoacetate);oxotitanium (PubChem CID 50910318) has the molecular formula C4H2O9Ti-2
and a molecular weight of 241.92 g/mol. Its IUPAC name is bis(2-hydroxy-2-oxoacetate);oxotitanium.
Molecular Properties
| Compound Name | bis(2-hydroxy-2-oxoacetate);oxotitanium |
| PubChem CID | 50910318 |
| Molecular Formula | C4H2O9Ti-2 |
| Molecular Weight | 241.92 g/mol |
| Exact Mass | 241.92 |
| IUPAC Name | bis(2-hydroxy-2-oxoacetate);oxotitanium |
| SMILES | O=C([O-])C(=O)O.O=C([O-])C(=O)O.O=[Ti] |
| InChI | InChI=1S/2C2H2O4.O.Ti/c2*3-1(4)2(5)6;;/h2*(H,3,4)(H,5,6);;/p-2 |
| InChIKey | ADHNMQXQIHSDHE-UHFFFAOYSA-L |
| XLogP | -4.48 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.92 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxy-2-oxoacetate);oxotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxy-2-oxoacetate);oxotitanium?
The IUPAC name of bis(2-hydroxy-2-oxoacetate);oxotitanium (CID 50910318) is bis(2-hydroxy-2-oxoacetate);oxotitanium.
What is the SMILES notation for bis(2-hydroxy-2-oxoacetate);oxotitanium?
The canonical SMILES for bis(2-hydroxy-2-oxoacetate);oxotitanium is O=C([O-])C(=O)O.O=C([O-])C(=O)O.O=[Ti].
What is the InChIKey of bis(2-hydroxy-2-oxoacetate);oxotitanium?
The InChIKey is ADHNMQXQIHSDHE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H2O4.O.Ti/c2*3-1(4)2(5)6;;/h2*(H,3,4)(H,5,6);;/p-2.
What are the key properties of bis(2-hydroxy-2-oxoacetate);oxotitanium?
bis(2-hydroxy-2-oxoacetate);oxotitanium has a molecular weight of 241.92 g/mol, XLogP of -4.48, 0 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxy-2-oxoacetate);oxotitanium is sourced from PubChem (CID 50910318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).