About dicalcium;oxalate;oxygen(2-)
dicalcium;oxalate;oxygen(2-) (PubChem CID 172811671) has the molecular formula C2Ca2O5
and a molecular weight of 184.17 g/mol. Its IUPAC name is dicalcium;oxalate;oxygen(2-).
Molecular Properties
| Compound Name | dicalcium;oxalate;oxygen(2-) |
| PubChem CID | 172811671 |
| Molecular Formula | C2Ca2O5 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 183.90 |
| IUPAC Name | dicalcium;oxalate;oxygen(2-) |
| SMILES | O=C([O-])C(=O)[O-].[Ca+2].[Ca+2].[O-2] |
| InChI | InChI=1S/C2H2O4.2Ca.O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;;/q;2*+2;-2/p-2 |
| InChIKey | SGJKYMASQCXNSS-UHFFFAOYSA-L |
| XLogP | -4.39 |
| TPSA | 108.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze dicalcium;oxalate;oxygen(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicalcium;oxalate;oxygen(2-)?
The IUPAC name of dicalcium;oxalate;oxygen(2-) (CID 172811671) is dicalcium;oxalate;oxygen(2-).
What is the SMILES notation for dicalcium;oxalate;oxygen(2-)?
The canonical SMILES for dicalcium;oxalate;oxygen(2-) is O=C([O-])C(=O)[O-].[Ca+2].[Ca+2].[O-2].
What is the InChIKey of dicalcium;oxalate;oxygen(2-)?
The InChIKey is SGJKYMASQCXNSS-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.2Ca.O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;;/q;2*+2;-2/p-2.
What are the key properties of dicalcium;oxalate;oxygen(2-)?
dicalcium;oxalate;oxygen(2-) has a molecular weight of 184.17 g/mol, XLogP of -4.39, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dicalcium;oxalate;oxygen(2-) is sourced from PubChem (CID 172811671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).