About aluminum;calcium;oxalate
aluminum;calcium;oxalate (PubChem CID 172855033) has the molecular formula C2AlCaO4+3
and a molecular weight of 155.08 g/mol. Its IUPAC name is aluminum;calcium;oxalate.
Molecular Properties
| Compound Name | aluminum;calcium;oxalate |
| PubChem CID | 172855033 |
| Molecular Formula | C2AlCaO4+3 |
| Molecular Weight | 155.08 g/mol |
| Exact Mass | 154.92 |
| IUPAC Name | aluminum;calcium;oxalate |
| SMILES | O=C([O-])C(=O)[O-].[Al+3].[Ca+2] |
| InChI | InChI=1S/C2H2O4.Al.Ca/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;+3;+2/p-2 |
| InChIKey | YOTJXZUPUMSAEC-UHFFFAOYSA-L |
| XLogP | -4.28 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.08 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze aluminum;calcium;oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;calcium;oxalate?
The IUPAC name of aluminum;calcium;oxalate (CID 172855033) is aluminum;calcium;oxalate.
What is the SMILES notation for aluminum;calcium;oxalate?
The canonical SMILES for aluminum;calcium;oxalate is O=C([O-])C(=O)[O-].[Al+3].[Ca+2].
What is the InChIKey of aluminum;calcium;oxalate?
The InChIKey is YOTJXZUPUMSAEC-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.Al.Ca/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;+3;+2/p-2.
What are the key properties of aluminum;calcium;oxalate?
aluminum;calcium;oxalate has a molecular weight of 155.08 g/mol, XLogP of -4.28, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;calcium;oxalate is sourced from PubChem (CID 172855033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).