C4H2K2O6 — CID 159492381
dipotassium;(Z)-1,4-dihydroxy-1,4-dioxobut-2-ene-2,3-diolate (PubChem CID 159492381) has the molecular formula C4H2K2O6 and a molecular weight of 224.25 g/mol. Its IUPAC name is dipotassium;(Z)-1,4-dihydroxy-1,4-dioxobut-2-ene-2,3-diolate.
| Compound Name | dipotassium;(Z)-1,4-dihydroxy-1,4-dioxobut-2-ene-2,3-diolate |
|---|---|
| PubChem CID | 159492381 |
| Molecular Formula | C4H2K2O6 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 223.91 |
| IUPAC Name | dipotassium;(Z)-1,4-dihydroxy-1,4-dioxobut-2-ene-2,3-diolate |
| SMILES | O=C(O)/C([O-])=C(/[O-])C(=O)O.[K+].[K+] |
| InChI | InChI=1S/C4H4O6.2K/c5-1(3(7)8)2(6)4(9)10;;/h5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/b2-1-;; |
| InChIKey | LYIXEZUAVLOQIM-UAIGNFCESA-L |
| XLogP | -8.90 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | -8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|