About hydron;oxalate;rubidium(1+)
hydron;oxalate;rubidium(1+) (PubChem CID 18408012) has the molecular formula C2HO4Rb
and a molecular weight of 174.49 g/mol. Its IUPAC name is hydron;oxalate;rubidium(1+).
Molecular Properties
| Compound Name | hydron;oxalate;rubidium(1+) |
| PubChem CID | 18408012 |
| Molecular Formula | C2HO4Rb |
| Molecular Weight | 174.49 g/mol |
| Exact Mass | 173.90 |
| IUPAC Name | hydron;oxalate;rubidium(1+) |
| SMILES | O=C([O-])C(=O)[O-].[H+].[Rb+] |
| InChI | InChI=1S/C2H2O4.Rb/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+1/p-1 |
| InChIKey | DTNAJOGBEWCPIB-UHFFFAOYSA-M |
| XLogP | -6.40 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.49 |
| LogP ≤ 5 | -6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze hydron;oxalate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;oxalate;rubidium(1+)?
The IUPAC name of hydron;oxalate;rubidium(1+) (CID 18408012) is hydron;oxalate;rubidium(1+).
What is the SMILES notation for hydron;oxalate;rubidium(1+)?
The canonical SMILES for hydron;oxalate;rubidium(1+) is O=C([O-])C(=O)[O-].[H+].[Rb+].
What is the InChIKey of hydron;oxalate;rubidium(1+)?
The InChIKey is DTNAJOGBEWCPIB-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H2O4.Rb/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+1/p-1.
What are the key properties of hydron;oxalate;rubidium(1+)?
hydron;oxalate;rubidium(1+) has a molecular weight of 174.49 g/mol, XLogP of -6.40, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;oxalate;rubidium(1+) is sourced from PubChem (CID 18408012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).