About lithium;hydron;oxalate
lithium;hydron;oxalate (PubChem CID 22141737) has the molecular formula C2HLiO4
and a molecular weight of 95.97 g/mol. Its IUPAC name is lithium;hydron;oxalate.
Molecular Properties
| Compound Name | lithium;hydron;oxalate |
| PubChem CID | 22141737 |
| Molecular Formula | C2HLiO4 |
| Molecular Weight | 95.97 g/mol |
| Exact Mass | 96.00 |
| IUPAC Name | lithium;hydron;oxalate |
| SMILES | O=C([O-])C(=O)[O-].[H+].[Li+] |
| InChI | InChI=1S/C2H2O4.Li/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+1/p-1 |
| InChIKey | DXUUIDJNCBRHDV-UHFFFAOYSA-M |
| XLogP | -6.40 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.97 |
| LogP ≤ 5 | -6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydron;oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydron;oxalate?
The IUPAC name of lithium;hydron;oxalate (CID 22141737) is lithium;hydron;oxalate.
What is the SMILES notation for lithium;hydron;oxalate?
The canonical SMILES for lithium;hydron;oxalate is O=C([O-])C(=O)[O-].[H+].[Li+].
What is the InChIKey of lithium;hydron;oxalate?
The InChIKey is DXUUIDJNCBRHDV-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H2O4.Li/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+1/p-1.
What are the key properties of lithium;hydron;oxalate?
lithium;hydron;oxalate has a molecular weight of 95.97 g/mol, XLogP of -6.40, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydron;oxalate is sourced from PubChem (CID 22141737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).