About azane;oxalate;palladium(2+)
azane;oxalate;palladium(2+) (PubChem CID 173089897) has the molecular formula C2H12N4O4Pd
and a molecular weight of 262.56 g/mol. Its IUPAC name is azane;oxalate;palladium(2+).
Molecular Properties
| Compound Name | azane;oxalate;palladium(2+) |
| PubChem CID | 173089897 |
| Molecular Formula | C2H12N4O4Pd |
| Molecular Weight | 262.56 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | azane;oxalate;palladium(2+) |
| SMILES | N.N.N.N.O=C([O-])C(=O)[O-].[Pd+2] |
| InChI | InChI=1S/C2H2O4.4H3N.Pd/c3-1(4)2(5)6;;;;;/h(H,3,4)(H,5,6);4*1H3;/q;;;;;+2/p-2 |
| InChIKey | SHSUWDPBLFAICM-UHFFFAOYSA-L |
| XLogP | -2.87 |
| TPSA | 220.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.56 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze azane;oxalate;palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;oxalate;palladium(2+)?
The IUPAC name of azane;oxalate;palladium(2+) (CID 173089897) is azane;oxalate;palladium(2+).
What is the SMILES notation for azane;oxalate;palladium(2+)?
The canonical SMILES for azane;oxalate;palladium(2+) is N.N.N.N.O=C([O-])C(=O)[O-].[Pd+2].
What is the InChIKey of azane;oxalate;palladium(2+)?
The InChIKey is SHSUWDPBLFAICM-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.4H3N.Pd/c3-1(4)2(5)6;;;;;/h(H,3,4)(H,5,6);4*1H3;/q;;;;;+2/p-2.
What are the key properties of azane;oxalate;palladium(2+)?
azane;oxalate;palladium(2+) has a molecular weight of 262.56 g/mol, XLogP of -2.87, 0 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for azane;oxalate;palladium(2+) is sourced from PubChem (CID 173089897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).