C10H12O5-2 — CID 54707971
(6E,8E)-10-hydroxy-9-oxido-10-oxodeca-6,8-dienoate (PubChem CID 54707971) has the molecular formula C10H12O5-2 and a molecular weight of 212.20 g/mol. Its IUPAC name is (6E,8E)-10-hydroxy-9-oxido-10-oxodeca-6,8-dienoate.
| Compound Name | (6E,8E)-10-hydroxy-9-oxido-10-oxodeca-6,8-dienoate |
|---|---|
| PubChem CID | 54707971 |
| Molecular Formula | C10H12O5-2 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (6E,8E)-10-hydroxy-9-oxido-10-oxodeca-6,8-dienoate |
| SMILES | O=C([O-])CCCC/C=C/C=C(/[O-])C(=O)O |
| InChI | InChI=1S/C10H14O5/c11-8(10(14)15)6-4-2-1-3-5-7-9(12)13/h2,4,6,11H,1,3,5,7H2,(H,12,13)(H,14,15)/p-2/b4-2+,8-6+ |
| InChIKey | MPFLOVTXQFENDL-REBBJWOHSA-L |
| XLogP | -0.82 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|