C18H27O2- — CID 5460991
(9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoate (PubChem CID 5460991) has the molecular formula C18H27O2- and a molecular weight of 275.41 g/mol. Its IUPAC name is (9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoate.
| Compound Name | (9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoate |
|---|---|
| PubChem CID | 5460991 |
| Molecular Formula | C18H27O2- |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | (9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-10H,2,11-17H2,1H3,(H,19,20)/p-1/b4-3+,6-5+,8-7+,10-9+ |
| InChIKey | IJTNSXPMYKJZPR-BYFNFPHLSA-M |
| XLogP | 4.10 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|