C36H58CaO4 — CID 22645987
calcium bis((9E,12E,15E)-octadeca-9,12,15-trienoate) (PubChem CID 22645987) has the molecular formula C36H58CaO4 and a molecular weight of 594.93 g/mol. Its IUPAC name is calcium bis((9E,12E,15E)-octadeca-9,12,15-trienoate).
| Compound Name | calcium bis((9E,12E,15E)-octadeca-9,12,15-trienoate) |
|---|---|
| PubChem CID | 22645987 |
| Molecular Formula | C36H58CaO4 |
| Molecular Weight | 594.93 g/mol |
| Exact Mass | 594.40 |
| IUPAC Name | calcium bis((9E,12E,15E)-octadeca-9,12,15-trienoate) |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)[O-].CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C18H30O2.Ca/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2*3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20);/q;;+2/p-2/b2*4-3+,7-6+,10-9+; |
| InChIKey | CIRHMZHRSIZIGV-KZZAEGNVSA-L |
| XLogP | 8.27 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.93 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|