C18H29NaO2 — CID 23676667
sodium (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 23676667) has the molecular formula C18H29NaO2 and a molecular weight of 300.42 g/mol. Its IUPAC name is sodium (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | sodium (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 23676667 |
| Molecular Formula | C18H29NaO2 |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | sodium (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H30O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20);/q;+1/p-1/b4-3-,7-6-,10-9-; |
| InChIKey | UNZSHUCNBUBSGW-IFNWOZJISA-M |
| XLogP | 1.33 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|