About (E)-oct-2-enedioate
(E)-oct-2-enedioate (PubChem CID 22622865) has the molecular formula C8H10O4-2
and a molecular weight of 170.16 g/mol. Its IUPAC name is (E)-oct-2-enedioate.
Molecular Properties
| Compound Name | (E)-oct-2-enedioate |
| PubChem CID | 22622865 |
| Molecular Formula | C8H10O4-2 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (E)-oct-2-enedioate |
| SMILES | O=C([O-])/C=C/CCCCC(=O)[O-] |
| InChI | InChI=1S/C8H12O4/c9-7(10)5-3-1-2-4-6-8(11)12/h3,5H,1-2,4,6H2,(H,9,10)(H,11,12)/p-2/b5-3+ |
| InChIKey | BNTPVRGYUHJFHN-HWKANZROSA-L |
| XLogP | -1.40 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-oct-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-oct-2-enedioate?
The IUPAC name of (E)-oct-2-enedioate (CID 22622865) is (E)-oct-2-enedioate.
What is the SMILES notation for (E)-oct-2-enedioate?
The canonical SMILES for (E)-oct-2-enedioate is O=C([O-])/C=C/CCCCC(=O)[O-].
What is the InChIKey of (E)-oct-2-enedioate?
The InChIKey is BNTPVRGYUHJFHN-HWKANZROSA-L. The full InChI is InChI=1S/C8H12O4/c9-7(10)5-3-1-2-4-6-8(11)12/h3,5H,1-2,4,6H2,(H,9,10)(H,11,12)/p-2/b5-3+.
What are the key properties of (E)-oct-2-enedioate?
(E)-oct-2-enedioate has a molecular weight of 170.16 g/mol, XLogP of -1.40, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-oct-2-enedioate is sourced from PubChem (CID 22622865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).