About (Z)-but-2-enedioate;hexanedioate
(Z)-but-2-enedioate;hexanedioate (PubChem CID 86743702) has the molecular formula C10H10O8-4
and a molecular weight of 258.18 g/mol. Its IUPAC name is (Z)-but-2-enedioate;hexanedioate.
Molecular Properties
| Compound Name | (Z)-but-2-enedioate;hexanedioate |
| PubChem CID | 86743702 |
| Molecular Formula | C10H10O8-4 |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (Z)-but-2-enedioate;hexanedioate |
| SMILES | O=C([O-])/C=C\C(=O)[O-].O=C([O-])CCCCC(=O)[O-] |
| InChI | InChI=1S/C6H10O4.C4H4O4/c7-5(8)3-1-2-4-6(9)10;5-3(6)1-2-4(7)8/h1-4H2,(H,7,8)(H,9,10);1-2H,(H,5,6)(H,7,8)/p-4/b;2-1- |
| InChIKey | ZWFDBRUSCVLUPK-BTJKTKAUSA-J |
| XLogP | -4.91 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioate;hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioate;hexanedioate?
The IUPAC name of (Z)-but-2-enedioate;hexanedioate (CID 86743702) is (Z)-but-2-enedioate;hexanedioate.
What is the SMILES notation for (Z)-but-2-enedioate;hexanedioate?
The canonical SMILES for (Z)-but-2-enedioate;hexanedioate is O=C([O-])/C=C\C(=O)[O-].O=C([O-])CCCCC(=O)[O-].
What is the InChIKey of (Z)-but-2-enedioate;hexanedioate?
The InChIKey is ZWFDBRUSCVLUPK-BTJKTKAUSA-J. The full InChI is InChI=1S/C6H10O4.C4H4O4/c7-5(8)3-1-2-4-6(9)10;5-3(6)1-2-4(7)8/h1-4H2,(H,7,8)(H,9,10);1-2H,(H,5,6)(H,7,8)/p-4/b;2-1-.
What are the key properties of (Z)-but-2-enedioate;hexanedioate?
(Z)-but-2-enedioate;hexanedioate has a molecular weight of 258.18 g/mol, XLogP of -4.91, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioate;hexanedioate is sourced from PubChem (CID 86743702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).