(2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid

C8H10O3 — CID 143334790

IUPAC(2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid
SMILESC=C/C=C(C(=O)O)\C(O)=C/C
InChIInChI=1S/C8H10O3/c1-3-5-6(8(10)11)7(9)4-2/h3-5,9H,1H2,2H3,(H,10,11)/b6-5+,7-4+
InChIKeyTXPZPKZYEHBXRH-HVUXDCMCSA-N
MW154.16 g/mol
LogP1.65
Rot. Bonds3

About (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid

(2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid (PubChem CID 143334790) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid.

Molecular Properties

Compound Name(2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid
PubChem CID143334790
Molecular FormulaC8H10O3
Molecular Weight154.16 g/mol
Exact Mass154.06
IUPAC Name(2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid
SMILESC=C/C=C(C(=O)O)\C(O)=C/C
InChIInChI=1S/C8H10O3/c1-3-5-6(8(10)11)7(9)4-2/h3-5,9H,1H2,2H3,(H,10,11)/b6-5+,7-4+
InChIKeyTXPZPKZYEHBXRH-HVUXDCMCSA-N
XLogP1.65
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.16
LogP ≤ 51.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid?
The IUPAC name of (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid (CID 143334790) is (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid.
What is the SMILES notation for (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid?
The canonical SMILES for (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid is C=C/C=C(C(=O)O)\C(O)=C/C.
What is the InChIKey of (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid?
The InChIKey is TXPZPKZYEHBXRH-HVUXDCMCSA-N. The full InChI is InChI=1S/C8H10O3/c1-3-5-6(8(10)11)7(9)4-2/h3-5,9H,1H2,2H3,(H,10,11)/b6-5+,7-4+.
What are the key properties of (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid?
(2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid has a molecular weight of 154.16 g/mol, XLogP of 1.65, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(E)-1-hydroxyprop-1-enyl]penta-2,4-dienoic acid is sourced from PubChem (CID 143334790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).