C9H12O2 — CID 142088410
(3E)-3-[(E)-1-hydroxyprop-1-enyl]hexa-3,5-dien-2-one (PubChem CID 142088410) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (3E)-3-[(E)-1-hydroxyprop-1-enyl]hexa-3,5-dien-2-one.
| Compound Name | (3E)-3-[(E)-1-hydroxyprop-1-enyl]hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 142088410 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (3E)-3-[(E)-1-hydroxyprop-1-enyl]hexa-3,5-dien-2-one |
| SMILES | C=C/C=C(C(C)=O)\C(O)=C/C |
| InChI | InChI=1S/C9H12O2/c1-4-6-8(7(3)10)9(11)5-2/h4-6,11H,1H2,2-3H3/b8-6-,9-5+ |
| InChIKey | VJYOQXUKBDLFIK-POEMVANMSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|